C22H25N4O2S+ — CID 9281487
1-[3-[[10-(morpholin-4-ium-4-ylmethyl)-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yl]amino]phenyl]ethanone (PubChem CID 9281487) has the molecular formula C22H25N4O2S+ and a molecular weight of 409.54 g/mol. Its IUPAC name is 1-[3-[[10-(morpholin-4-ium-4-ylmethyl)-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yl]amino]phenyl]ethanone.
| Compound Name | 1-[3-[[10-(morpholin-4-ium-4-ylmethyl)-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yl]amino]phenyl]ethanone |
|---|---|
| PubChem CID | 9281487 |
| Molecular Formula | C22H25N4O2S+ |
| Molecular Weight | 409.54 g/mol |
| Exact Mass | 409.17 |
| IUPAC Name | 1-[3-[[10-(morpholin-4-ium-4-ylmethyl)-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yl]amino]phenyl]ethanone |
| SMILES | CC(=O)c1cccc(Nc2nc(C[NH+]3CCOCC3)nc3sc4c(c23)CCC4)c1 |
| InChI | InChI=1S/C22H24N4O2S/c1-14(27)15-4-2-5-16(12-15)23-21-20-17-6-3-7-18(17)29-22(20)25-19(24-21)13-26-8-10-28-11-9-26/h2,4-5,12H,3,6-11,13H2,1H3,(H,23,24,25)/p+1 |
| InChIKey | KNWPDIHDDCNWKV-UHFFFAOYSA-O |
| XLogP | 2.54 |
| TPSA | 68.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.54 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |