C23H26BrN3OS2 — CID 2106349
(2R,6R)-4-[2-[(4-bromophenyl)sulfanylmethyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl]-2,6-dimethylmorpholine (PubChem CID 2106349) has the molecular formula C23H26BrN3OS2 and a molecular weight of 504.52 g/mol. Its IUPAC name is (2R,6R)-4-[2-[(4-bromophenyl)sulfanylmethyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl]-2,6-dimethylmorpholine.
| Compound Name | (2R,6R)-4-[2-[(4-bromophenyl)sulfanylmethyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl]-2,6-dimethylmorpholine |
|---|---|
| PubChem CID | 2106349 |
| Molecular Formula | C23H26BrN3OS2 |
| Molecular Weight | 504.52 g/mol |
| Exact Mass | 503.07 |
| IUPAC Name | (2R,6R)-4-[2-[(4-bromophenyl)sulfanylmethyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl]-2,6-dimethylmorpholine |
| SMILES | C[C@@H]1CN(c2nc(CSc3ccc(Br)cc3)nc3sc4c(c23)CCCC4)C[C@@H](C)O1 |
| InChI | InChI=1S/C23H26BrN3OS2/c1-14-11-27(12-15(2)28-14)22-21-18-5-3-4-6-19(18)30-23(21)26-20(25-22)13-29-17-9-7-16(24)8-10-17/h7-10,14-15H,3-6,11-13H2,1-2H3/t14-,15-/m1/s1 |
| InChIKey | CYLLDBTUDLHYQD-HUUCEWRRSA-N |
| XLogP | 6.24 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.52 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |