C22H27N4S2+ — CID 9311465
12-(4-methyl-1,4-diazepan-4-ium-1-yl)-10-(phenylsulfanylmethyl)-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraene (PubChem CID 9311465) has the molecular formula C22H27N4S2+ and a molecular weight of 411.62 g/mol. Its IUPAC name is 12-(4-methyl-1,4-diazepan-4-ium-1-yl)-10-(phenylsulfanylmethyl)-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraene.
| Compound Name | 12-(4-methyl-1,4-diazepan-4-ium-1-yl)-10-(phenylsulfanylmethyl)-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraene |
|---|---|
| PubChem CID | 9311465 |
| Molecular Formula | C22H27N4S2+ |
| Molecular Weight | 411.62 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | 12-(4-methyl-1,4-diazepan-4-ium-1-yl)-10-(phenylsulfanylmethyl)-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraene |
| SMILES | C[NH+]1CCCN(c2nc(CSc3ccccc3)nc3sc4c(c23)CCC4)CC1 |
| InChI | InChI=1S/C22H26N4S2/c1-25-11-6-12-26(14-13-25)21-20-17-9-5-10-18(17)28-22(20)24-19(23-21)15-27-16-7-3-2-4-8-16/h2-4,7-8H,5-6,9-15H2,1H3/p+1 |
| InChIKey | UTGYKCJHVIRHKW-UHFFFAOYSA-O |
| XLogP | 3.20 |
| TPSA | 33.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.62 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |