C22H21N3O5S — CID 92830192
[(Z)-4-amino-3-cyano-2-oxopent-3-enyl] 3-[[(2S)-2-methyl-2,3-dihydroindol-1-yl]sulfonyl]benzoate (PubChem CID 92830192) has the molecular formula C22H21N3O5S and a molecular weight of 439.49 g/mol. Its IUPAC name is [(Z)-4-amino-3-cyano-2-oxopent-3-enyl] 3-[[(2S)-2-methyl-2,3-dihydroindol-1-yl]sulfonyl]benzoate.
| Compound Name | [(Z)-4-amino-3-cyano-2-oxopent-3-enyl] 3-[[(2S)-2-methyl-2,3-dihydroindol-1-yl]sulfonyl]benzoate |
|---|---|
| PubChem CID | 92830192 |
| Molecular Formula | C22H21N3O5S |
| Molecular Weight | 439.49 g/mol |
| Exact Mass | 439.12 |
| IUPAC Name | [(Z)-4-amino-3-cyano-2-oxopent-3-enyl] 3-[[(2S)-2-methyl-2,3-dihydroindol-1-yl]sulfonyl]benzoate |
| SMILES | C/C(N)=C(\C#N)C(=O)COC(=O)c1cccc(S(=O)(=O)N2c3ccccc3C[C@@H]2C)c1 |
| InChI | InChI=1S/C22H21N3O5S/c1-14-10-16-6-3-4-9-20(16)25(14)31(28,29)18-8-5-7-17(11-18)22(27)30-13-21(26)19(12-23)15(2)24/h3-9,11,14H,10,13,24H2,1-2H3/b19-15-/t14-/m0/s1 |
| InChIKey | VUXBVKJBXXUEFO-SQQITKIUSA-N |
| XLogP | 2.31 |
| TPSA | 130.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.49 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|