C13H20O5S — CID 92836097
diethyl (2S,3S,5R,6S)-2,6-dimethyl-4-oxothiane-3,5-dicarboxylate (PubChem CID 92836097) has the molecular formula C13H20O5S and a molecular weight of 288.37 g/mol. Its IUPAC name is diethyl (2S,3S,5R,6S)-2,6-dimethyl-4-oxothiane-3,5-dicarboxylate.
| Compound Name | diethyl (2S,3S,5R,6S)-2,6-dimethyl-4-oxothiane-3,5-dicarboxylate |
|---|---|
| PubChem CID | 92836097 |
| Molecular Formula | C13H20O5S |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | diethyl (2S,3S,5R,6S)-2,6-dimethyl-4-oxothiane-3,5-dicarboxylate |
| SMILES | CCOC(=O)[C@@H]1C(=O)[C@H](C(=O)OCC)[C@H](C)S[C@H]1C |
| InChI | InChI=1S/C13H20O5S/c1-5-17-12(15)9-7(3)19-8(4)10(11(9)14)13(16)18-6-2/h7-10H,5-6H2,1-4H3/t7-,8-,9-,10+/m0/s1 |
| InChIKey | DTCBUAQEHFOPCO-AATLWQCWSA-N |
| XLogP | 1.44 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|