C19H31N3S — CID 9283871
1-cyclopropyl-3-[3-(dimethylamino)propyl]-1-[(4-propan-2-ylphenyl)methyl]thiourea (PubChem CID 9283871) has the molecular formula C19H31N3S and a molecular weight of 333.55 g/mol. Its IUPAC name is 1-cyclopropyl-3-[3-(dimethylamino)propyl]-1-[(4-propan-2-ylphenyl)methyl]thiourea.
| Compound Name | 1-cyclopropyl-3-[3-(dimethylamino)propyl]-1-[(4-propan-2-ylphenyl)methyl]thiourea |
|---|---|
| PubChem CID | 9283871 |
| Molecular Formula | C19H31N3S |
| Molecular Weight | 333.55 g/mol |
| Exact Mass | 333.22 |
| IUPAC Name | 1-cyclopropyl-3-[3-(dimethylamino)propyl]-1-[(4-propan-2-ylphenyl)methyl]thiourea |
| SMILES | CC(C)c1ccc(CN(C(=S)NCCCN(C)C)C2CC2)cc1 |
| InChI | InChI=1S/C19H31N3S/c1-15(2)17-8-6-16(7-9-17)14-22(18-10-11-18)19(23)20-12-5-13-21(3)4/h6-9,15,18H,5,10-14H2,1-4H3,(H,20,23) |
| InChIKey | FGBIBWGRHNLEKF-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.55 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|