C23H26N4O5 — CID 92842699
methyl (2R)-3-(1H-indol-3-yl)-2-[[2-[methyl(phenylmethoxycarbonylamino)amino]acetyl]amino]propanoate (PubChem CID 92842699) has the molecular formula C23H26N4O5 and a molecular weight of 438.48 g/mol. Its IUPAC name is methyl (2R)-3-(1H-indol-3-yl)-2-[[2-[methyl(phenylmethoxycarbonylamino)amino]acetyl]amino]propanoate.
| Compound Name | methyl (2R)-3-(1H-indol-3-yl)-2-[[2-[methyl(phenylmethoxycarbonylamino)amino]acetyl]amino]propanoate |
|---|---|
| PubChem CID | 92842699 |
| Molecular Formula | C23H26N4O5 |
| Molecular Weight | 438.48 g/mol |
| Exact Mass | 438.19 |
| IUPAC Name | methyl (2R)-3-(1H-indol-3-yl)-2-[[2-[methyl(phenylmethoxycarbonylamino)amino]acetyl]amino]propanoate |
| SMILES | COC(=O)[C@@H](Cc1c[nH]c2ccccc12)NC(=O)CN(C)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C23H26N4O5/c1-27(26-23(30)32-15-16-8-4-3-5-9-16)14-21(28)25-20(22(29)31-2)12-17-13-24-19-11-7-6-10-18(17)19/h3-11,13,20,24H,12,14-15H2,1-2H3,(H,25,28)(H,26,30)/t20-/m1/s1 |
| InChIKey | SGMSLIIPVFFQGR-HXUWFJFHSA-N |
| XLogP | 2.14 |
| TPSA | 112.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.48 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|