C33H38FN3O7 — CID 92854038
(3S,4S)-3-(2-fluorophenyl)-6,7-dimethoxy-2-methyl-4-[4-[(2,3,4-trimethoxyphenyl)methyl]piperazine-1-carbonyl]-3,4-dihydroisoquinolin-1-one (PubChem CID 92854038) has the molecular formula C33H38FN3O7 and a molecular weight of 607.68 g/mol. Its IUPAC name is (3S,4S)-3-(2-fluorophenyl)-6,7-dimethoxy-2-methyl-4-[4-[(2,3,4-trimethoxyphenyl)methyl]piperazine-1-carbonyl]-3,4-dihydroisoquinolin-1-one.
| Compound Name | (3S,4S)-3-(2-fluorophenyl)-6,7-dimethoxy-2-methyl-4-[4-[(2,3,4-trimethoxyphenyl)methyl]piperazine-1-carbonyl]-3,4-dihydroisoquinolin-1-one |
|---|---|
| PubChem CID | 92854038 |
| Molecular Formula | C33H38FN3O7 |
| Molecular Weight | 607.68 g/mol |
| Exact Mass | 607.27 |
| IUPAC Name | (3S,4S)-3-(2-fluorophenyl)-6,7-dimethoxy-2-methyl-4-[4-[(2,3,4-trimethoxyphenyl)methyl]piperazine-1-carbonyl]-3,4-dihydroisoquinolin-1-one |
| SMILES | COc1cc2c(cc1OC)[C@H](C(=O)N1CCN(Cc3ccc(OC)c(OC)c3OC)CC1)[C@@H](c1ccccc1F)N(C)C2=O |
| InChI | InChI=1S/C33H38FN3O7/c1-35-29(21-9-7-8-10-24(21)34)28(22-17-26(41-3)27(42-4)18-23(22)32(35)38)33(39)37-15-13-36(14-16-37)19-20-11-12-25(40-2)31(44-6)30(20)43-5/h7-12,17-18,28-29H,13-16,19H2,1-6H3/t28-,29+/m0/s1 |
| InChIKey | BFSGTWSRSPXIRI-URLMMPGGSA-N |
| XLogP | 4.12 |
| TPSA | 90.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.68 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |