C21H21N5 — CID 92854396
(1R)-1-(1-methylimidazol-2-yl)-1-phenyl-N-[(1-phenylpyrazol-4-yl)methyl]methanamine (PubChem CID 92854396) has the molecular formula C21H21N5 and a molecular weight of 343.43 g/mol. Its IUPAC name is (1R)-1-(1-methylimidazol-2-yl)-1-phenyl-N-[(1-phenylpyrazol-4-yl)methyl]methanamine.
| Compound Name | (1R)-1-(1-methylimidazol-2-yl)-1-phenyl-N-[(1-phenylpyrazol-4-yl)methyl]methanamine |
|---|---|
| PubChem CID | 92854396 |
| Molecular Formula | C21H21N5 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.18 |
| IUPAC Name | (1R)-1-(1-methylimidazol-2-yl)-1-phenyl-N-[(1-phenylpyrazol-4-yl)methyl]methanamine |
| SMILES | Cn1ccnc1[C@H](NCc1cnn(-c2ccccc2)c1)c1ccccc1 |
| InChI | InChI=1S/C21H21N5/c1-25-13-12-22-21(25)20(18-8-4-2-5-9-18)23-14-17-15-24-26(16-17)19-10-6-3-7-11-19/h2-13,15-16,20,23H,14H2,1H3/t20-/m1/s1 |
| InChIKey | MMCXIKQEUSLCOG-HXUWFJFHSA-N |
| XLogP | 3.48 |
| TPSA | 47.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |