C20H19NO3 — CID 92857426
(2S)-2-morpholin-4-yl-2,5-diphenylfuran-3-one (PubChem CID 92857426) has the molecular formula C20H19NO3 and a molecular weight of 321.38 g/mol. Its IUPAC name is (2S)-2-morpholin-4-yl-2,5-diphenylfuran-3-one.
| Compound Name | (2S)-2-morpholin-4-yl-2,5-diphenylfuran-3-one |
|---|---|
| PubChem CID | 92857426 |
| Molecular Formula | C20H19NO3 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | (2S)-2-morpholin-4-yl-2,5-diphenylfuran-3-one |
| SMILES | O=C1C=C(c2ccccc2)O[C@]1(c1ccccc1)N1CCOCC1 |
| InChI | InChI=1S/C20H19NO3/c22-19-15-18(16-7-3-1-4-8-16)24-20(19,17-9-5-2-6-10-17)21-11-13-23-14-12-21/h1-10,15H,11-14H2/t20-/m0/s1 |
| InChIKey | CSPRRYASADTUIN-FQEVSTJZSA-N |
| XLogP | 2.81 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |