C29H23NO5 — CID 133083422
2-morpholin-4-yl-3-phenacylidene-2-phenylfuro[3,2-c]chromen-4-one (PubChem CID 133083422) has the molecular formula C29H23NO5 and a molecular weight of 465.51 g/mol. Its IUPAC name is 2-morpholin-4-yl-3-phenacylidene-2-phenylfuro[3,2-c]chromen-4-one.
| Compound Name | 2-morpholin-4-yl-3-phenacylidene-2-phenylfuro[3,2-c]chromen-4-one |
|---|---|
| PubChem CID | 133083422 |
| Molecular Formula | C29H23NO5 |
| Molecular Weight | 465.51 g/mol |
| Exact Mass | 465.16 |
| IUPAC Name | 2-morpholin-4-yl-3-phenacylidene-2-phenylfuro[3,2-c]chromen-4-one |
| SMILES | O=C(C=C1c2c(c3ccccc3oc2=O)OC1(c1ccccc1)N1CCOCC1)c1ccccc1 |
| InChI | InChI=1S/C29H23NO5/c31-24(20-9-3-1-4-10-20)19-23-26-27(22-13-7-8-14-25(22)34-28(26)32)35-29(23,21-11-5-2-6-12-21)30-15-17-33-18-16-30/h1-14,19H,15-18H2 |
| InChIKey | DHPXGQLZKVBGMO-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 68.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.51 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|