C17H22N4O3 — CID 9286078
N-cyclopropyl-2-[methyl-[[(4R)-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]methyl]amino]acetamide (PubChem CID 9286078) has the molecular formula C17H22N4O3 and a molecular weight of 330.39 g/mol. Its IUPAC name is N-cyclopropyl-2-[methyl-[[(4R)-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]methyl]amino]acetamide.
| Compound Name | N-cyclopropyl-2-[methyl-[[(4R)-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]methyl]amino]acetamide |
|---|---|
| PubChem CID | 9286078 |
| Molecular Formula | C17H22N4O3 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | N-cyclopropyl-2-[methyl-[[(4R)-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]methyl]amino]acetamide |
| SMILES | CN(CC(=O)NC1CC1)CN1C(=O)N[C@](C)(c2ccccc2)C1=O |
| InChI | InChI=1S/C17H22N4O3/c1-17(12-6-4-3-5-7-12)15(23)21(16(24)19-17)11-20(2)10-14(22)18-13-8-9-13/h3-7,13H,8-11H2,1-2H3,(H,18,22)(H,19,24)/t17-/m1/s1 |
| InChIKey | MGAWHODDVJURAA-QGZVFWFLSA-N |
| XLogP | 0.62 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|