C27H28N6O3 — CID 92863490
(2S)-2-[4-(imidazo[1,2-a]pyridin-2-ylmethyl)piperazin-1-yl]-N-(4-methyl-2-nitrophenyl)-2-phenylacetamide (PubChem CID 92863490) has the molecular formula C27H28N6O3 and a molecular weight of 484.56 g/mol. Its IUPAC name is (2S)-2-[4-(imidazo[1,2-a]pyridin-2-ylmethyl)piperazin-1-yl]-N-(4-methyl-2-nitrophenyl)-2-phenylacetamide.
| Compound Name | (2S)-2-[4-(imidazo[1,2-a]pyridin-2-ylmethyl)piperazin-1-yl]-N-(4-methyl-2-nitrophenyl)-2-phenylacetamide |
|---|---|
| PubChem CID | 92863490 |
| Molecular Formula | C27H28N6O3 |
| Molecular Weight | 484.56 g/mol |
| Exact Mass | 484.22 |
| IUPAC Name | (2S)-2-[4-(imidazo[1,2-a]pyridin-2-ylmethyl)piperazin-1-yl]-N-(4-methyl-2-nitrophenyl)-2-phenylacetamide |
| SMILES | Cc1ccc(NC(=O)[C@H](c2ccccc2)N2CCN(Cc3cn4ccccc4n3)CC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C27H28N6O3/c1-20-10-11-23(24(17-20)33(35)36)29-27(34)26(21-7-3-2-4-8-21)31-15-13-30(14-16-31)18-22-19-32-12-6-5-9-25(32)28-22/h2-12,17,19,26H,13-16,18H2,1H3,(H,29,34)/t26-/m0/s1 |
| InChIKey | WGLQAPOQUDKSJT-SANMLTNESA-N |
| XLogP | 4.05 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.56 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|