C25H25FN4O3 — CID 46800952
2-[4-(4-fluorophenyl)piperazin-1-yl]-N-(4-methyl-2-nitrophenyl)-2-phenylacetamide (PubChem CID 46800952) has the molecular formula C25H25FN4O3 and a molecular weight of 448.50 g/mol. Its IUPAC name is 2-[4-(4-fluorophenyl)piperazin-1-yl]-N-(4-methyl-2-nitrophenyl)-2-phenylacetamide.
| Compound Name | 2-[4-(4-fluorophenyl)piperazin-1-yl]-N-(4-methyl-2-nitrophenyl)-2-phenylacetamide |
|---|---|
| PubChem CID | 46800952 |
| Molecular Formula | C25H25FN4O3 |
| Molecular Weight | 448.50 g/mol |
| Exact Mass | 448.19 |
| IUPAC Name | 2-[4-(4-fluorophenyl)piperazin-1-yl]-N-(4-methyl-2-nitrophenyl)-2-phenylacetamide |
| SMILES | Cc1ccc(NC(=O)C(c2ccccc2)N2CCN(c3ccc(F)cc3)CC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C25H25FN4O3/c1-18-7-12-22(23(17-18)30(32)33)27-25(31)24(19-5-3-2-4-6-19)29-15-13-28(14-16-29)21-10-8-20(26)9-11-21/h2-12,17,24H,13-16H2,1H3,(H,27,31) |
| InChIKey | OTISQCRDAJYIQE-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 78.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.50 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|