C22H29N3O3 — CID 92864183
N-[3-[(2S,6S)-2,6-dimethylpiperidin-1-yl]propyl]-8-methyl-4H-chromeno[3,4-d][1,2]oxazole-3-carboxamide (PubChem CID 92864183) has the molecular formula C22H29N3O3 and a molecular weight of 383.49 g/mol. Its IUPAC name is N-[3-[(2S,6S)-2,6-dimethylpiperidin-1-yl]propyl]-8-methyl-4H-chromeno[3,4-d][1,2]oxazole-3-carboxamide.
| Compound Name | N-[3-[(2S,6S)-2,6-dimethylpiperidin-1-yl]propyl]-8-methyl-4H-chromeno[3,4-d][1,2]oxazole-3-carboxamide |
|---|---|
| PubChem CID | 92864183 |
| Molecular Formula | C22H29N3O3 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.22 |
| IUPAC Name | N-[3-[(2S,6S)-2,6-dimethylpiperidin-1-yl]propyl]-8-methyl-4H-chromeno[3,4-d][1,2]oxazole-3-carboxamide |
| SMILES | Cc1ccc2c(c1)-c1onc(C(=O)NCCCN3[C@@H](C)CCC[C@@H]3C)c1CO2 |
| InChI | InChI=1S/C22H29N3O3/c1-14-8-9-19-17(12-14)21-18(13-27-19)20(24-28-21)22(26)23-10-5-11-25-15(2)6-4-7-16(25)3/h8-9,12,15-16H,4-7,10-11,13H2,1-3H3,(H,23,26)/t15-,16-/m0/s1 |
| InChIKey | GJKAMNGTAPIQJX-HOTGVXAUSA-N |
| XLogP | 3.93 |
| TPSA | 67.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|