C28H27ClN2O2 — CID 92867750
2-(3-chlorophenyl)-4-ethoxy-N-[(2R)-4-phenylbutan-2-yl]quinoline-6-carboxamide (PubChem CID 92867750) has the molecular formula C28H27ClN2O2 and a molecular weight of 458.99 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-4-ethoxy-N-[(2R)-4-phenylbutan-2-yl]quinoline-6-carboxamide.
| Compound Name | 2-(3-chlorophenyl)-4-ethoxy-N-[(2R)-4-phenylbutan-2-yl]quinoline-6-carboxamide |
|---|---|
| PubChem CID | 92867750 |
| Molecular Formula | C28H27ClN2O2 |
| Molecular Weight | 458.99 g/mol |
| Exact Mass | 458.18 |
| IUPAC Name | 2-(3-chlorophenyl)-4-ethoxy-N-[(2R)-4-phenylbutan-2-yl]quinoline-6-carboxamide |
| SMILES | CCOc1cc(-c2cccc(Cl)c2)nc2ccc(C(=O)N[C@H](C)CCc3ccccc3)cc12 |
| InChI | InChI=1S/C28H27ClN2O2/c1-3-33-27-18-26(21-10-7-11-23(29)16-21)31-25-15-14-22(17-24(25)27)28(32)30-19(2)12-13-20-8-5-4-6-9-20/h4-11,14-19H,3,12-13H2,1-2H3,(H,30,32)/t19-/m1/s1 |
| InChIKey | FKYGMFBTEANOHE-LJQANCHMSA-N |
| XLogP | 6.70 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.99 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |