C25H42N4O2 — CID 92871462
N-[3-[(2R)-2-ethylpiperidin-1-yl]propyl]-2-[1-(3,4,5-trimethyl-1H-pyrrole-2-carbonyl)piperidin-4-yl]acetamide (PubChem CID 92871462) has the molecular formula C25H42N4O2 and a molecular weight of 430.64 g/mol. Its IUPAC name is N-[3-[(2R)-2-ethylpiperidin-1-yl]propyl]-2-[1-(3,4,5-trimethyl-1H-pyrrole-2-carbonyl)piperidin-4-yl]acetamide.
| Compound Name | N-[3-[(2R)-2-ethylpiperidin-1-yl]propyl]-2-[1-(3,4,5-trimethyl-1H-pyrrole-2-carbonyl)piperidin-4-yl]acetamide |
|---|---|
| PubChem CID | 92871462 |
| Molecular Formula | C25H42N4O2 |
| Molecular Weight | 430.64 g/mol |
| Exact Mass | 430.33 |
| IUPAC Name | N-[3-[(2R)-2-ethylpiperidin-1-yl]propyl]-2-[1-(3,4,5-trimethyl-1H-pyrrole-2-carbonyl)piperidin-4-yl]acetamide |
| SMILES | CC[C@@H]1CCCCN1CCCNC(=O)CC1CCN(C(=O)c2[nH]c(C)c(C)c2C)CC1 |
| InChI | InChI=1S/C25H42N4O2/c1-5-22-9-6-7-13-28(22)14-8-12-26-23(30)17-21-10-15-29(16-11-21)25(31)24-19(3)18(2)20(4)27-24/h21-22,27H,5-17H2,1-4H3,(H,26,30)/t22-/m1/s1 |
| InChIKey | RCGHDEMPSRDLJK-JOCHJYFZSA-N |
| XLogP | 3.95 |
| TPSA | 68.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.64 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|