C19H20ClNO2 — CID 92878431
4-[(4aS,5S,10bS)-9-methyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-5-yl]-2-chlorophenol (PubChem CID 92878431) has the molecular formula C19H20ClNO2 and a molecular weight of 329.83 g/mol. Its IUPAC name is 4-[(4aS,5S,10bS)-9-methyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-5-yl]-2-chlorophenol.
| Compound Name | 4-[(4aS,5S,10bS)-9-methyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-5-yl]-2-chlorophenol |
|---|---|
| PubChem CID | 92878431 |
| Molecular Formula | C19H20ClNO2 |
| Molecular Weight | 329.83 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | 4-[(4aS,5S,10bS)-9-methyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-5-yl]-2-chlorophenol |
| SMILES | Cc1ccc2c(c1)[C@H]1OCCC[C@H]1[C@@H](c1ccc(O)c(Cl)c1)N2 |
| InChI | InChI=1S/C19H20ClNO2/c1-11-4-6-16-14(9-11)19-13(3-2-8-23-19)18(21-16)12-5-7-17(22)15(20)10-12/h4-7,9-10,13,18-19,21-22H,2-3,8H2,1H3/t13-,18+,19-/m0/s1 |
| InChIKey | OMMRYRVEKWNDOL-BKTGTZMESA-N |
| XLogP | 4.99 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.83 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |