C23H32N4S — CID 92879088
1-[(E)-[4-[butyl(ethyl)amino]phenyl]methylideneamino]-3-(4-propan-2-ylphenyl)thiourea (PubChem CID 92879088) has the molecular formula C23H32N4S and a molecular weight of 396.60 g/mol. Its IUPAC name is 1-[(E)-[4-[butyl(ethyl)amino]phenyl]methylideneamino]-3-(4-propan-2-ylphenyl)thiourea.
| Compound Name | 1-[(E)-[4-[butyl(ethyl)amino]phenyl]methylideneamino]-3-(4-propan-2-ylphenyl)thiourea |
|---|---|
| PubChem CID | 92879088 |
| Molecular Formula | C23H32N4S |
| Molecular Weight | 396.60 g/mol |
| Exact Mass | 396.23 |
| IUPAC Name | 1-[(E)-[4-[butyl(ethyl)amino]phenyl]methylideneamino]-3-(4-propan-2-ylphenyl)thiourea |
| SMILES | CCCCN(CC)c1ccc(/C=N/NC(=S)Nc2ccc(C(C)C)cc2)cc1 |
| InChI | InChI=1S/C23H32N4S/c1-5-7-16-27(6-2)22-14-8-19(9-15-22)17-24-26-23(28)25-21-12-10-20(11-13-21)18(3)4/h8-15,17-18H,5-7,16H2,1-4H3,(H2,25,26,28)/b24-17+ |
| InChIKey | VCAQAWZSGOQFMG-JJIBRWJFSA-N |
| XLogP | 5.76 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.60 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|