C21H26FN3O3 — CID 92880705
(2R)-N-cycloheptyl-2-[1-(4-fluorophenyl)-6-oxopyridazin-3-yl]oxybutanamide (PubChem CID 92880705) has the molecular formula C21H26FN3O3 and a molecular weight of 387.46 g/mol. Its IUPAC name is (2R)-N-cycloheptyl-2-[1-(4-fluorophenyl)-6-oxopyridazin-3-yl]oxybutanamide.
| Compound Name | (2R)-N-cycloheptyl-2-[1-(4-fluorophenyl)-6-oxopyridazin-3-yl]oxybutanamide |
|---|---|
| PubChem CID | 92880705 |
| Molecular Formula | C21H26FN3O3 |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 387.20 |
| IUPAC Name | (2R)-N-cycloheptyl-2-[1-(4-fluorophenyl)-6-oxopyridazin-3-yl]oxybutanamide |
| SMILES | CC[C@@H](Oc1ccc(=O)n(-c2ccc(F)cc2)n1)C(=O)NC1CCCCCC1 |
| InChI | InChI=1S/C21H26FN3O3/c1-2-18(21(27)23-16-7-5-3-4-6-8-16)28-19-13-14-20(26)25(24-19)17-11-9-15(22)10-12-17/h9-14,16,18H,2-8H2,1H3,(H,23,27)/t18-/m1/s1 |
| InChIKey | HETAZZZBXYONBC-GOSISDBHSA-N |
| XLogP | 3.37 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |