C22H20FN3O4 — CID 92895677
(2R)-N-(4-acetylphenyl)-2-[1-(4-fluorophenyl)-6-oxopyridazin-3-yl]oxybutanamide (PubChem CID 92895677) has the molecular formula C22H20FN3O4 and a molecular weight of 409.42 g/mol. Its IUPAC name is (2R)-N-(4-acetylphenyl)-2-[1-(4-fluorophenyl)-6-oxopyridazin-3-yl]oxybutanamide.
| Compound Name | (2R)-N-(4-acetylphenyl)-2-[1-(4-fluorophenyl)-6-oxopyridazin-3-yl]oxybutanamide |
|---|---|
| PubChem CID | 92895677 |
| Molecular Formula | C22H20FN3O4 |
| Molecular Weight | 409.42 g/mol |
| Exact Mass | 409.14 |
| IUPAC Name | (2R)-N-(4-acetylphenyl)-2-[1-(4-fluorophenyl)-6-oxopyridazin-3-yl]oxybutanamide |
| SMILES | CC[C@@H](Oc1ccc(=O)n(-c2ccc(F)cc2)n1)C(=O)Nc1ccc(C(C)=O)cc1 |
| InChI | InChI=1S/C22H20FN3O4/c1-3-19(22(29)24-17-8-4-15(5-9-17)14(2)27)30-20-12-13-21(28)26(25-20)18-10-6-16(23)7-11-18/h4-13,19H,3H2,1-2H3,(H,24,29)/t19-/m1/s1 |
| InChIKey | YQNITOZJMVISPZ-LJQANCHMSA-N |
| XLogP | 3.37 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.42 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |