C22H25N3O — CID 92883104
N-[[(3R)-1-[(4-methylphenyl)methyl]pyrrolidin-3-yl]methyl]indolizine-2-carboxamide (PubChem CID 92883104) has the molecular formula C22H25N3O and a molecular weight of 347.46 g/mol. Its IUPAC name is N-[[(3R)-1-[(4-methylphenyl)methyl]pyrrolidin-3-yl]methyl]indolizine-2-carboxamide.
| Compound Name | N-[[(3R)-1-[(4-methylphenyl)methyl]pyrrolidin-3-yl]methyl]indolizine-2-carboxamide |
|---|---|
| PubChem CID | 92883104 |
| Molecular Formula | C22H25N3O |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.20 |
| IUPAC Name | N-[[(3R)-1-[(4-methylphenyl)methyl]pyrrolidin-3-yl]methyl]indolizine-2-carboxamide |
| SMILES | Cc1ccc(CN2CC[C@H](CNC(=O)c3cc4ccccn4c3)C2)cc1 |
| InChI | InChI=1S/C22H25N3O/c1-17-5-7-18(8-6-17)14-24-11-9-19(15-24)13-23-22(26)20-12-21-4-2-3-10-25(21)16-20/h2-8,10,12,16,19H,9,11,13-15H2,1H3,(H,23,26)/t19-/m1/s1 |
| InChIKey | AKQZSYGMOWBUQP-LJQANCHMSA-N |
| XLogP | 3.50 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |