C27H34N4OS — CID 92885044
(3R)-N-[[4-(4-methylpiperidin-1-yl)phenyl]methyl]-1-(2-methylthieno[3,2-c]pyridin-4-yl)piperidine-3-carboxamide (PubChem CID 92885044) has the molecular formula C27H34N4OS and a molecular weight of 462.66 g/mol. Its IUPAC name is (3R)-N-[[4-(4-methylpiperidin-1-yl)phenyl]methyl]-1-(2-methylthieno[3,2-c]pyridin-4-yl)piperidine-3-carboxamide.
| Compound Name | (3R)-N-[[4-(4-methylpiperidin-1-yl)phenyl]methyl]-1-(2-methylthieno[3,2-c]pyridin-4-yl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 92885044 |
| Molecular Formula | C27H34N4OS |
| Molecular Weight | 462.66 g/mol |
| Exact Mass | 462.25 |
| IUPAC Name | (3R)-N-[[4-(4-methylpiperidin-1-yl)phenyl]methyl]-1-(2-methylthieno[3,2-c]pyridin-4-yl)piperidine-3-carboxamide |
| SMILES | Cc1cc2c(N3CCC[C@@H](C(=O)NCc4ccc(N5CCC(C)CC5)cc4)C3)nccc2s1 |
| InChI | InChI=1S/C27H34N4OS/c1-19-10-14-30(15-11-19)23-7-5-21(6-8-23)17-29-27(32)22-4-3-13-31(18-22)26-24-16-20(2)33-25(24)9-12-28-26/h5-9,12,16,19,22H,3-4,10-11,13-15,17-18H2,1-2H3,(H,29,32)/t22-/m1/s1 |
| InChIKey | UHDODDHTRWBFBI-JOCHJYFZSA-N |
| XLogP | 5.37 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.66 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|