C20H28N4O4S — CID 92889862
(3S)-N-cycloheptyl-1-[5-(1H-pyrazol-5-yl)furan-2-yl]sulfonylpiperidine-3-carboxamide (PubChem CID 92889862) has the molecular formula C20H28N4O4S and a molecular weight of 420.54 g/mol. Its IUPAC name is (3S)-N-cycloheptyl-1-[5-(1H-pyrazol-5-yl)furan-2-yl]sulfonylpiperidine-3-carboxamide.
| Compound Name | (3S)-N-cycloheptyl-1-[5-(1H-pyrazol-5-yl)furan-2-yl]sulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 92889862 |
| Molecular Formula | C20H28N4O4S |
| Molecular Weight | 420.54 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | (3S)-N-cycloheptyl-1-[5-(1H-pyrazol-5-yl)furan-2-yl]sulfonylpiperidine-3-carboxamide |
| SMILES | O=C(NC1CCCCCC1)[C@H]1CCCN(S(=O)(=O)c2ccc(-c3ccn[nH]3)o2)C1 |
| InChI | InChI=1S/C20H28N4O4S/c25-20(22-16-7-3-1-2-4-8-16)15-6-5-13-24(14-15)29(26,27)19-10-9-18(28-19)17-11-12-21-23-17/h9-12,15-16H,1-8,13-14H2,(H,21,23)(H,22,25)/t15-/m0/s1 |
| InChIKey | XREVSDITJCUHMH-HNNXBMFYSA-N |
| XLogP | 2.91 |
| TPSA | 108.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.54 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |