C18H24N4O4S — CID 92889865
(3R)-N-cyclopentyl-1-[5-(1H-pyrazol-5-yl)furan-2-yl]sulfonylpiperidine-3-carboxamide (PubChem CID 92889865) has the molecular formula C18H24N4O4S and a molecular weight of 392.48 g/mol. Its IUPAC name is (3R)-N-cyclopentyl-1-[5-(1H-pyrazol-5-yl)furan-2-yl]sulfonylpiperidine-3-carboxamide.
| Compound Name | (3R)-N-cyclopentyl-1-[5-(1H-pyrazol-5-yl)furan-2-yl]sulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 92889865 |
| Molecular Formula | C18H24N4O4S |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | (3R)-N-cyclopentyl-1-[5-(1H-pyrazol-5-yl)furan-2-yl]sulfonylpiperidine-3-carboxamide |
| SMILES | O=C(NC1CCCC1)[C@@H]1CCCN(S(=O)(=O)c2ccc(-c3ccn[nH]3)o2)C1 |
| InChI | InChI=1S/C18H24N4O4S/c23-18(20-14-5-1-2-6-14)13-4-3-11-22(12-13)27(24,25)17-8-7-16(26-17)15-9-10-19-21-15/h7-10,13-14H,1-6,11-12H2,(H,19,21)(H,20,23)/t13-/m1/s1 |
| InChIKey | MWBKIZYULAFXPP-CYBMUJFWSA-N |
| XLogP | 2.13 |
| TPSA | 108.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |