C18H28N2O3 — CID 9289571
[2-oxo-2-(2,4,4-trimethylpentan-2-ylamino)ethyl] 3-amino-4-methylbenzoate (PubChem CID 9289571) has the molecular formula C18H28N2O3 and a molecular weight of 320.43 g/mol. Its IUPAC name is [2-oxo-2-(2,4,4-trimethylpentan-2-ylamino)ethyl] 3-amino-4-methylbenzoate.
| Compound Name | [2-oxo-2-(2,4,4-trimethylpentan-2-ylamino)ethyl] 3-amino-4-methylbenzoate |
|---|---|
| PubChem CID | 9289571 |
| Molecular Formula | C18H28N2O3 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.21 |
| IUPAC Name | [2-oxo-2-(2,4,4-trimethylpentan-2-ylamino)ethyl] 3-amino-4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)OCC(=O)NC(C)(C)CC(C)(C)C)cc1N |
| InChI | InChI=1S/C18H28N2O3/c1-12-7-8-13(9-14(12)19)16(22)23-10-15(21)20-18(5,6)11-17(2,3)4/h7-9H,10-11,19H2,1-6H3,(H,20,21) |
| InChIKey | YGHQNZVVRGBEKM-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|