C16H18N6O3S — CID 9290167
N-[(4S)-4-methyl-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]-2-(1H-1,2,4-triazol-5-ylsulfanyl)acetamide (PubChem CID 9290167) has the molecular formula C16H18N6O3S and a molecular weight of 374.43 g/mol. Its IUPAC name is N-[(4S)-4-methyl-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]-2-(1H-1,2,4-triazol-5-ylsulfanyl)acetamide.
| Compound Name | N-[(4S)-4-methyl-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]-2-(1H-1,2,4-triazol-5-ylsulfanyl)acetamide |
|---|---|
| PubChem CID | 9290167 |
| Molecular Formula | C16H18N6O3S |
| Molecular Weight | 374.43 g/mol |
| Exact Mass | 374.12 |
| IUPAC Name | N-[(4S)-4-methyl-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]-2-(1H-1,2,4-triazol-5-ylsulfanyl)acetamide |
| SMILES | C[C@@]1(CCc2ccccc2)NC(=O)N(NC(=O)CSc2ncn[nH]2)C1=O |
| InChI | InChI=1S/C16H18N6O3S/c1-16(8-7-11-5-3-2-4-6-11)13(24)22(15(25)19-16)21-12(23)9-26-14-17-10-18-20-14/h2-6,10H,7-9H2,1H3,(H,19,25)(H,21,23)(H,17,18,20)/t16-/m0/s1 |
| InChIKey | WQFWOWKFYMVTKE-INIZCTEOSA-N |
| XLogP | 0.87 |
| TPSA | 120.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.43 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|