C16H20O3 — CID 929018
[(1R,9S,12S,14R)-9-methyl-8,15-dioxatetracyclo[10.2.2.02,7.09,14]hexadeca-2,4,6-trien-12-yl]methanol (PubChem CID 929018) has the molecular formula C16H20O3 and a molecular weight of 260.33 g/mol. Its IUPAC name is [(1R,9S,12S,14R)-9-methyl-8,15-dioxatetracyclo[10.2.2.02,7.09,14]hexadeca-2,4,6-trien-12-yl]methanol.
| Compound Name | [(1R,9S,12S,14R)-9-methyl-8,15-dioxatetracyclo[10.2.2.02,7.09,14]hexadeca-2,4,6-trien-12-yl]methanol |
|---|---|
| PubChem CID | 929018 |
| Molecular Formula | C16H20O3 |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | [(1R,9S,12S,14R)-9-methyl-8,15-dioxatetracyclo[10.2.2.02,7.09,14]hexadeca-2,4,6-trien-12-yl]methanol |
| SMILES | C[C@@]12CC[C@]3(CO)CO[C@@H](c4ccccc4O1)[C@H]2C3 |
| InChI | InChI=1S/C16H20O3/c1-15-6-7-16(9-17)8-12(15)14(18-10-16)11-4-2-3-5-13(11)19-15/h2-5,12,14,17H,6-10H2,1H3/t12-,14+,15+,16+/m1/s1 |
| InChIKey | JPABUXDNLBKOTH-OEAJRASXSA-N |
| XLogP | 2.69 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |