C20H26O4 — CID 40543419
[(1S,9R,11S,12R,13S,14R)-9,11,13-trimethyl-8,15-dioxatetracyclo[10.2.2.02,7.09,14]hexadeca-2,4,6-trien-12-yl]methyl acetate (PubChem CID 40543419) has the molecular formula C20H26O4 and a molecular weight of 330.42 g/mol. Its IUPAC name is [(1S,9R,11S,12R,13S,14R)-9,11,13-trimethyl-8,15-dioxatetracyclo[10.2.2.02,7.09,14]hexadeca-2,4,6-trien-12-yl]methyl acetate.
| Compound Name | [(1S,9R,11S,12R,13S,14R)-9,11,13-trimethyl-8,15-dioxatetracyclo[10.2.2.02,7.09,14]hexadeca-2,4,6-trien-12-yl]methyl acetate |
|---|---|
| PubChem CID | 40543419 |
| Molecular Formula | C20H26O4 |
| Molecular Weight | 330.42 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | [(1S,9R,11S,12R,13S,14R)-9,11,13-trimethyl-8,15-dioxatetracyclo[10.2.2.02,7.09,14]hexadeca-2,4,6-trien-12-yl]methyl acetate |
| SMILES | CC(=O)OC[C@]12CO[C@@H]3c4ccccc4O[C@](C)(C[C@@H]1C)[C@@H]3[C@@H]2C |
| InChI | InChI=1S/C20H26O4/c1-12-9-19(4)17-13(2)20(12,10-22-14(3)21)11-23-18(17)15-7-5-6-8-16(15)24-19/h5-8,12-13,17-18H,9-11H2,1-4H3/t12-,13-,17+,18+,19+,20-/m0/s1 |
| InChIKey | YMPPYMYJLCYPBO-QBTFJOKOSA-N |
| XLogP | 3.75 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.42 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |