C24H29BrN2O4 — CID 124716885
[(1S,9R,11S,12S,13R,14S)-9,11,13-trimethyl-8,15-dioxatetracyclo[10.2.2.02,7.09,14]hexadeca-2,4,6-trien-12-yl]methyl 4-bromo-1-ethylpyrazole-3-carboxylate (PubChem CID 124716885) has the molecular formula C24H29BrN2O4 and a molecular weight of 489.41 g/mol. Its IUPAC name is [(1S,9R,11S,12S,13R,14S)-9,11,13-trimethyl-8,15-dioxatetracyclo[10.2.2.02,7.09,14]hexadeca-2,4,6-trien-12-yl]methyl 4-bromo-1-ethylpyrazole-3-carboxylate.
| Compound Name | [(1S,9R,11S,12S,13R,14S)-9,11,13-trimethyl-8,15-dioxatetracyclo[10.2.2.02,7.09,14]hexadeca-2,4,6-trien-12-yl]methyl 4-bromo-1-ethylpyrazole-3-carboxylate |
|---|---|
| PubChem CID | 124716885 |
| Molecular Formula | C24H29BrN2O4 |
| Molecular Weight | 489.41 g/mol |
| Exact Mass | 488.13 |
| IUPAC Name | [(1S,9R,11S,12S,13R,14S)-9,11,13-trimethyl-8,15-dioxatetracyclo[10.2.2.02,7.09,14]hexadeca-2,4,6-trien-12-yl]methyl 4-bromo-1-ethylpyrazole-3-carboxylate |
| SMILES | CCn1cc(Br)c(C(=O)OC[C@@]23CO[C@@H]4c5ccccc5O[C@](C)(C[C@@H]2C)[C@H]4[C@H]3C)n1 |
| InChI | InChI=1S/C24H29BrN2O4/c1-5-27-11-17(25)20(26-27)22(28)30-13-24-12-29-21-16-8-6-7-9-18(16)31-23(4,10-14(24)2)19(21)15(24)3/h6-9,11,14-15,19,21H,5,10,12-13H2,1-4H3/t14-,15+,19-,21+,23+,24-/m0/s1 |
| InChIKey | VBAFVMCTAYYKPV-MLGGYGHPSA-N |
| XLogP | 5.02 |
| TPSA | 62.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.41 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |