C21H25N5O2 — CID 92902798
N-[(2R)-butan-2-yl]-2-[11-(4-methylphenyl)-2-oxo-1,8,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),9,11-trien-8-yl]acetamide (PubChem CID 92902798) has the molecular formula C21H25N5O2 and a molecular weight of 379.46 g/mol. Its IUPAC name is N-[(2R)-butan-2-yl]-2-[11-(4-methylphenyl)-2-oxo-1,8,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),9,11-trien-8-yl]acetamide.
| Compound Name | N-[(2R)-butan-2-yl]-2-[11-(4-methylphenyl)-2-oxo-1,8,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),9,11-trien-8-yl]acetamide |
|---|---|
| PubChem CID | 92902798 |
| Molecular Formula | C21H25N5O2 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.20 |
| IUPAC Name | N-[(2R)-butan-2-yl]-2-[11-(4-methylphenyl)-2-oxo-1,8,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),9,11-trien-8-yl]acetamide |
| SMILES | CC[C@@H](C)NC(=O)Cn1c2c(c(=O)n3nc(-c4ccc(C)cc4)nc13)CCC2 |
| InChI | InChI=1S/C21H25N5O2/c1-4-14(3)22-18(27)12-25-17-7-5-6-16(17)20(28)26-21(25)23-19(24-26)15-10-8-13(2)9-11-15/h8-11,14H,4-7,12H2,1-3H3,(H,22,27)/t14-/m1/s1 |
| InChIKey | GRTMNBHTYBTACR-CQSZACIVSA-N |
| XLogP | 2.27 |
| TPSA | 81.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |