C29H35N7O4 — CID 92906050
(3S)-N-[3-(3,4-diethoxyphenyl)-1,2-oxazol-5-yl]-1-(7,8,9,10-tetrahydro-6H-purino[9,8-a]azepin-4-yl)piperidine-3-carboxamide (PubChem CID 92906050) has the molecular formula C29H35N7O4 and a molecular weight of 545.64 g/mol. Its IUPAC name is (3S)-N-[3-(3,4-diethoxyphenyl)-1,2-oxazol-5-yl]-1-(7,8,9,10-tetrahydro-6H-purino[9,8-a]azepin-4-yl)piperidine-3-carboxamide.
| Compound Name | (3S)-N-[3-(3,4-diethoxyphenyl)-1,2-oxazol-5-yl]-1-(7,8,9,10-tetrahydro-6H-purino[9,8-a]azepin-4-yl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 92906050 |
| Molecular Formula | C29H35N7O4 |
| Molecular Weight | 545.64 g/mol |
| Exact Mass | 545.28 |
| IUPAC Name | (3S)-N-[3-(3,4-diethoxyphenyl)-1,2-oxazol-5-yl]-1-(7,8,9,10-tetrahydro-6H-purino[9,8-a]azepin-4-yl)piperidine-3-carboxamide |
| SMILES | CCOc1ccc(-c2cc(NC(=O)[C@H]3CCCN(c4ncnc5c4nc4n5CCCCC4)C3)on2)cc1OCC |
| InChI | InChI=1S/C29H35N7O4/c1-3-38-22-12-11-19(15-23(22)39-4-2)21-16-25(40-34-21)33-29(37)20-9-8-13-35(17-20)27-26-28(31-18-30-27)36-14-7-5-6-10-24(36)32-26/h11-12,15-16,18,20H,3-10,13-14,17H2,1-2H3,(H,33,37)/t20-/m0/s1 |
| InChIKey | JFNHOHAKYQCAPL-FQEVSTJZSA-N |
| XLogP | 4.86 |
| TPSA | 120.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.64 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |