C14H25N3O5 — CID 92928341
(2R)-2-[[4-(2-acetamidoethylamino)-4-oxobutanoyl]amino]-4-methylpentanoic acid (PubChem CID 92928341) has the molecular formula C14H25N3O5 and a molecular weight of 315.37 g/mol. Its IUPAC name is (2R)-2-[[4-(2-acetamidoethylamino)-4-oxobutanoyl]amino]-4-methylpentanoic acid.
| Compound Name | (2R)-2-[[4-(2-acetamidoethylamino)-4-oxobutanoyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 92928341 |
| Molecular Formula | C14H25N3O5 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.18 |
| IUPAC Name | (2R)-2-[[4-(2-acetamidoethylamino)-4-oxobutanoyl]amino]-4-methylpentanoic acid |
| SMILES | CC(=O)NCCNC(=O)CCC(=O)N[C@H](CC(C)C)C(=O)O |
| InChI | InChI=1S/C14H25N3O5/c1-9(2)8-11(14(21)22)17-13(20)5-4-12(19)16-7-6-15-10(3)18/h9,11H,4-8H2,1-3H3,(H,15,18)(H,16,19)(H,17,20)(H,21,22)/t11-/m1/s1 |
| InChIKey | FAKCTSZMPPIORI-LLVKDONJSA-N |
| XLogP | -0.37 |
| TPSA | 124.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|