C19H26N3O3+ — CID 9293148
2-(1,3-dioxo-4H-isoquinolin-2-yl)-N-(1-propylpiperidin-1-ium-4-yl)acetamide (PubChem CID 9293148) has the molecular formula C19H26N3O3+ and a molecular weight of 344.44 g/mol. Its IUPAC name is 2-(1,3-dioxo-4H-isoquinolin-2-yl)-N-(1-propylpiperidin-1-ium-4-yl)acetamide.
| Compound Name | 2-(1,3-dioxo-4H-isoquinolin-2-yl)-N-(1-propylpiperidin-1-ium-4-yl)acetamide |
|---|---|
| PubChem CID | 9293148 |
| Molecular Formula | C19H26N3O3+ |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | 2-(1,3-dioxo-4H-isoquinolin-2-yl)-N-(1-propylpiperidin-1-ium-4-yl)acetamide |
| SMILES | CCC[NH+]1CCC(NC(=O)CN2C(=O)Cc3ccccc3C2=O)CC1 |
| InChI | InChI=1S/C19H25N3O3/c1-2-9-21-10-7-15(8-11-21)20-17(23)13-22-18(24)12-14-5-3-4-6-16(14)19(22)25/h3-6,15H,2,7-13H2,1H3,(H,20,23)/p+1 |
| InChIKey | KCOQHVBGBPVGPF-UHFFFAOYSA-O |
| XLogP | -0.22 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|