C19H15BrFNO5 — CID 92938631
[(2R)-1-(1,3-benzodioxol-5-ylamino)-1-oxopropan-2-yl] (Z)-3-(5-bromo-2-fluorophenyl)prop-2-enoate (PubChem CID 92938631) has the molecular formula C19H15BrFNO5 and a molecular weight of 436.23 g/mol. Its IUPAC name is [(2R)-1-(1,3-benzodioxol-5-ylamino)-1-oxopropan-2-yl] (Z)-3-(5-bromo-2-fluorophenyl)prop-2-enoate.
| Compound Name | [(2R)-1-(1,3-benzodioxol-5-ylamino)-1-oxopropan-2-yl] (Z)-3-(5-bromo-2-fluorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 92938631 |
| Molecular Formula | C19H15BrFNO5 |
| Molecular Weight | 436.23 g/mol |
| Exact Mass | 435.01 |
| IUPAC Name | [(2R)-1-(1,3-benzodioxol-5-ylamino)-1-oxopropan-2-yl] (Z)-3-(5-bromo-2-fluorophenyl)prop-2-enoate |
| SMILES | C[C@@H](OC(=O)/C=C\c1cc(Br)ccc1F)C(=O)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C19H15BrFNO5/c1-11(19(24)22-14-4-6-16-17(9-14)26-10-25-16)27-18(23)7-2-12-8-13(20)3-5-15(12)21/h2-9,11H,10H2,1H3,(H,22,24)/b7-2-/t11-/m1/s1 |
| InChIKey | MGVPKEDLJJCVLC-IGVIJBNESA-N |
| XLogP | 3.90 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.23 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|