C16H13BrFNO4 — CID 7500220
(2R)-N-(1,3-benzodioxol-5-yl)-2-(4-bromo-2-fluorophenoxy)propanamide (PubChem CID 7500220) has the molecular formula C16H13BrFNO4 and a molecular weight of 382.19 g/mol. Its IUPAC name is (2R)-N-(1,3-benzodioxol-5-yl)-2-(4-bromo-2-fluorophenoxy)propanamide.
| Compound Name | (2R)-N-(1,3-benzodioxol-5-yl)-2-(4-bromo-2-fluorophenoxy)propanamide |
|---|---|
| PubChem CID | 7500220 |
| Molecular Formula | C16H13BrFNO4 |
| Molecular Weight | 382.19 g/mol |
| Exact Mass | 381.00 |
| IUPAC Name | (2R)-N-(1,3-benzodioxol-5-yl)-2-(4-bromo-2-fluorophenoxy)propanamide |
| SMILES | C[C@@H](Oc1ccc(Br)cc1F)C(=O)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C16H13BrFNO4/c1-9(23-13-4-2-10(17)6-12(13)18)16(20)19-11-3-5-14-15(7-11)22-8-21-14/h2-7,9H,8H2,1H3,(H,19,20)/t9-/m1/s1 |
| InChIKey | KUUPVQXVLKFDKK-SECBINFHSA-N |
| XLogP | 3.72 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.19 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |