C17H15NO5 — CID 7762815
(2S)-N-(1,3-benzodioxol-5-yl)-2-(2-formylphenoxy)propanamide (PubChem CID 7762815) has the molecular formula C17H15NO5 and a molecular weight of 313.31 g/mol. Its IUPAC name is (2S)-N-(1,3-benzodioxol-5-yl)-2-(2-formylphenoxy)propanamide.
| Compound Name | (2S)-N-(1,3-benzodioxol-5-yl)-2-(2-formylphenoxy)propanamide |
|---|---|
| PubChem CID | 7762815 |
| Molecular Formula | C17H15NO5 |
| Molecular Weight | 313.31 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | (2S)-N-(1,3-benzodioxol-5-yl)-2-(2-formylphenoxy)propanamide |
| SMILES | C[C@H](Oc1ccccc1C=O)C(=O)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C17H15NO5/c1-11(23-14-5-3-2-4-12(14)9-19)17(20)18-13-6-7-15-16(8-13)22-10-21-15/h2-9,11H,10H2,1H3,(H,18,20)/t11-/m0/s1 |
| InChIKey | CREFWVLNJUMBDQ-NSHDSACASA-N |
| XLogP | 2.63 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.31 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|