C11H17NO5 — CID 92950874
diethyl (4R)-3-oxopiperidine-1,4-dicarboxylate (PubChem CID 92950874) has the molecular formula C11H17NO5 and a molecular weight of 243.26 g/mol. Its IUPAC name is diethyl (4R)-3-oxopiperidine-1,4-dicarboxylate.
| Compound Name | diethyl (4R)-3-oxopiperidine-1,4-dicarboxylate |
|---|---|
| PubChem CID | 92950874 |
| Molecular Formula | C11H17NO5 |
| Molecular Weight | 243.26 g/mol |
| Exact Mass | 243.11 |
| IUPAC Name | diethyl (4R)-3-oxopiperidine-1,4-dicarboxylate |
| SMILES | CCOC(=O)[C@@H]1CCN(C(=O)OCC)CC1=O |
| InChI | InChI=1S/C11H17NO5/c1-3-16-10(14)8-5-6-12(7-9(8)13)11(15)17-4-2/h8H,3-7H2,1-2H3/t8-/m1/s1 |
| InChIKey | ZYDLREJETGYCGW-MRVPVSSYSA-N |
| XLogP | 0.60 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.26 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|