C16H16F3NO4 — CID 84579394
ethyl 3-oxo-1-[2-(trifluoromethyl)benzoyl]piperidine-4-carboxylate (PubChem CID 84579394) has the molecular formula C16H16F3NO4 and a molecular weight of 343.30 g/mol. Its IUPAC name is ethyl 3-oxo-1-[2-(trifluoromethyl)benzoyl]piperidine-4-carboxylate.
| Compound Name | ethyl 3-oxo-1-[2-(trifluoromethyl)benzoyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 84579394 |
| Molecular Formula | C16H16F3NO4 |
| Molecular Weight | 343.30 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | ethyl 3-oxo-1-[2-(trifluoromethyl)benzoyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C(=O)c2ccccc2C(F)(F)F)CC1=O |
| InChI | InChI=1S/C16H16F3NO4/c1-2-24-15(23)11-7-8-20(9-13(11)21)14(22)10-5-3-4-6-12(10)16(17,18)19/h3-6,11H,2,7-9H2,1H3 |
| InChIKey | BAAVGQPYPFVHKV-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.30 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|