C17H18FN3O6S — CID 9295134
N-(2-amino-2-oxoethyl)-5-[(2-fluorophenyl)sulfamoyl]-2,3-dimethoxybenzamide (PubChem CID 9295134) has the molecular formula C17H18FN3O6S and a molecular weight of 411.41 g/mol. Its IUPAC name is N-(2-amino-2-oxoethyl)-5-[(2-fluorophenyl)sulfamoyl]-2,3-dimethoxybenzamide.
| Compound Name | N-(2-amino-2-oxoethyl)-5-[(2-fluorophenyl)sulfamoyl]-2,3-dimethoxybenzamide |
|---|---|
| PubChem CID | 9295134 |
| Molecular Formula | C17H18FN3O6S |
| Molecular Weight | 411.41 g/mol |
| Exact Mass | 411.09 |
| IUPAC Name | N-(2-amino-2-oxoethyl)-5-[(2-fluorophenyl)sulfamoyl]-2,3-dimethoxybenzamide |
| SMILES | COc1cc(S(=O)(=O)Nc2ccccc2F)cc(C(=O)NCC(N)=O)c1OC |
| InChI | InChI=1S/C17H18FN3O6S/c1-26-14-8-10(28(24,25)21-13-6-4-3-5-12(13)18)7-11(16(14)27-2)17(23)20-9-15(19)22/h3-8,21H,9H2,1-2H3,(H2,19,22)(H,20,23) |
| InChIKey | MUVQPDDJEQSQTN-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 136.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.41 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |