C12H16Cl2O3 — CID 92953615
(2R)-4-chloro-1-(4-chlorophenyl)-1,1-dimethoxybutan-2-ol (PubChem CID 92953615) has the molecular formula C12H16Cl2O3 and a molecular weight of 279.16 g/mol. Its IUPAC name is (2R)-4-chloro-1-(4-chlorophenyl)-1,1-dimethoxybutan-2-ol.
| Compound Name | (2R)-4-chloro-1-(4-chlorophenyl)-1,1-dimethoxybutan-2-ol |
|---|---|
| PubChem CID | 92953615 |
| Molecular Formula | C12H16Cl2O3 |
| Molecular Weight | 279.16 g/mol |
| Exact Mass | 278.05 |
| IUPAC Name | (2R)-4-chloro-1-(4-chlorophenyl)-1,1-dimethoxybutan-2-ol |
| SMILES | COC(OC)(c1ccc(Cl)cc1)[C@H](O)CCCl |
| InChI | InChI=1S/C12H16Cl2O3/c1-16-12(17-2,11(15)7-8-13)9-3-5-10(14)6-4-9/h3-6,11,15H,7-8H2,1-2H3/t11-/m1/s1 |
| InChIKey | SOYDQPROSDZXGA-LLVKDONJSA-N |
| XLogP | 2.78 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.16 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|