C11H14F2O3 — CID 22993491
1-(3,4-difluorophenyl)-1,1-dimethoxypropan-2-ol (PubChem CID 22993491) has the molecular formula C11H14F2O3 and a molecular weight of 232.23 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)-1,1-dimethoxypropan-2-ol.
| Compound Name | 1-(3,4-difluorophenyl)-1,1-dimethoxypropan-2-ol |
|---|---|
| PubChem CID | 22993491 |
| Molecular Formula | C11H14F2O3 |
| Molecular Weight | 232.23 g/mol |
| Exact Mass | 232.09 |
| IUPAC Name | 1-(3,4-difluorophenyl)-1,1-dimethoxypropan-2-ol |
| SMILES | COC(OC)(c1ccc(F)c(F)c1)C(C)O |
| InChI | InChI=1S/C11H14F2O3/c1-7(14)11(15-2,16-3)8-4-5-9(12)10(13)6-8/h4-7,14H,1-3H3 |
| InChIKey | OEQIGIFUNDLIEE-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.23 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|