C20H24N2O2 — CID 92968617
1-[(3S)-3,4-dihydro-2H-chromen-3-yl]-4-(4-methoxyphenyl)piperazine (PubChem CID 92968617) has the molecular formula C20H24N2O2 and a molecular weight of 324.42 g/mol. Its IUPAC name is 1-[(3S)-3,4-dihydro-2H-chromen-3-yl]-4-(4-methoxyphenyl)piperazine.
| Compound Name | 1-[(3S)-3,4-dihydro-2H-chromen-3-yl]-4-(4-methoxyphenyl)piperazine |
|---|---|
| PubChem CID | 92968617 |
| Molecular Formula | C20H24N2O2 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | 1-[(3S)-3,4-dihydro-2H-chromen-3-yl]-4-(4-methoxyphenyl)piperazine |
| SMILES | COc1ccc(N2CCN([C@@H]3COc4ccccc4C3)CC2)cc1 |
| InChI | InChI=1S/C20H24N2O2/c1-23-19-8-6-17(7-9-19)21-10-12-22(13-11-21)18-14-16-4-2-3-5-20(16)24-15-18/h2-9,18H,10-15H2,1H3/t18-/m0/s1 |
| InChIKey | VMPHADROCGUHCO-SFHVURJKSA-N |
| XLogP | 2.82 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|