C22H25N3O3 — CID 9297003
1-[3-[[(1R)-2-morpholin-4-yl-2-oxo-1-phenylethyl]amino]phenyl]pyrrolidin-2-one (PubChem CID 9297003) has the molecular formula C22H25N3O3 and a molecular weight of 379.46 g/mol. Its IUPAC name is 1-[3-[[(1R)-2-morpholin-4-yl-2-oxo-1-phenylethyl]amino]phenyl]pyrrolidin-2-one.
| Compound Name | 1-[3-[[(1R)-2-morpholin-4-yl-2-oxo-1-phenylethyl]amino]phenyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 9297003 |
| Molecular Formula | C22H25N3O3 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | 1-[3-[[(1R)-2-morpholin-4-yl-2-oxo-1-phenylethyl]amino]phenyl]pyrrolidin-2-one |
| SMILES | O=C([C@H](Nc1cccc(N2CCCC2=O)c1)c1ccccc1)N1CCOCC1 |
| InChI | InChI=1S/C22H25N3O3/c26-20-10-5-11-25(20)19-9-4-8-18(16-19)23-21(17-6-2-1-3-7-17)22(27)24-12-14-28-15-13-24/h1-4,6-9,16,21,23H,5,10-15H2/t21-/m1/s1 |
| InChIKey | ZEHMTHMSFCUGMH-OAQYLSRUSA-N |
| XLogP | 2.83 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |