C21H30O5 — CID 92973085
methyl (1aR,1bS,3aR,4R,7aS,9aR)-1b-hydroxy-4,7a-dimethyl-9-oxo-9a-propan-2-yl-2,3,3a,5,6,7-hexahydro-1aH-phenanthro[1,2-b]oxirene-4-carboxylate (PubChem CID 92973085) has the molecular formula C21H30O5 and a molecular weight of 362.47 g/mol. Its IUPAC name is methyl (1aR,1bS,3aR,4R,7aS,9aR)-1b-hydroxy-4,7a-dimethyl-9-oxo-9a-propan-2-yl-2,3,3a,5,6,7-hexahydro-1aH-phenanthro[1,2-b]oxirene-4-carboxylate.
| Compound Name | methyl (1aR,1bS,3aR,4R,7aS,9aR)-1b-hydroxy-4,7a-dimethyl-9-oxo-9a-propan-2-yl-2,3,3a,5,6,7-hexahydro-1aH-phenanthro[1,2-b]oxirene-4-carboxylate |
|---|---|
| PubChem CID | 92973085 |
| Molecular Formula | C21H30O5 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | methyl (1aR,1bS,3aR,4R,7aS,9aR)-1b-hydroxy-4,7a-dimethyl-9-oxo-9a-propan-2-yl-2,3,3a,5,6,7-hexahydro-1aH-phenanthro[1,2-b]oxirene-4-carboxylate |
| SMILES | COC(=O)[C@]1(C)CCC[C@]2(C)C3=CC(=O)[C@]4(C(C)C)O[C@@H]4[C@]3(O)CC[C@@H]12 |
| InChI | InChI=1S/C21H30O5/c1-12(2)21-15(22)11-14-18(3)8-6-9-19(4,17(23)25-5)13(18)7-10-20(14,24)16(21)26-21/h11-13,16,24H,6-10H2,1-5H3/t13-,16-,18+,19-,20+,21+/m1/s1 |
| InChIKey | ABKTWBMMVOBXFC-JNPGQTHHSA-N |
| XLogP | 2.80 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|