C16H18N2O5S2 — CID 9297424
N'-[2-[(3R)-1,1-dioxothiolan-3-yl]sulfanylacetyl]-3-methyl-1-benzofuran-2-carbohydrazide (PubChem CID 9297424) has the molecular formula C16H18N2O5S2 and a molecular weight of 382.46 g/mol. Its IUPAC name is N'-[2-[(3R)-1,1-dioxothiolan-3-yl]sulfanylacetyl]-3-methyl-1-benzofuran-2-carbohydrazide.
| Compound Name | N'-[2-[(3R)-1,1-dioxothiolan-3-yl]sulfanylacetyl]-3-methyl-1-benzofuran-2-carbohydrazide |
|---|---|
| PubChem CID | 9297424 |
| Molecular Formula | C16H18N2O5S2 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.07 |
| IUPAC Name | N'-[2-[(3R)-1,1-dioxothiolan-3-yl]sulfanylacetyl]-3-methyl-1-benzofuran-2-carbohydrazide |
| SMILES | Cc1c(C(=O)NNC(=O)CS[C@@H]2CCS(=O)(=O)C2)oc2ccccc12 |
| InChI | InChI=1S/C16H18N2O5S2/c1-10-12-4-2-3-5-13(12)23-15(10)16(20)18-17-14(19)8-24-11-6-7-25(21,22)9-11/h2-5,11H,6-9H2,1H3,(H,17,19)(H,18,20)/t11-/m1/s1 |
| InChIKey | JNWHWHLSQXMHRE-LLVKDONJSA-N |
| XLogP | 1.42 |
| TPSA | 105.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|