C13H15N — CID 92980020
(1R,5S)-3-phenyl-8-azabicyclo[3.2.1]oct-2-ene (PubChem CID 92980020) has the molecular formula C13H15N and a molecular weight of 185.27 g/mol. Its IUPAC name is (1R,5S)-3-phenyl-8-azabicyclo[3.2.1]oct-2-ene.
| Compound Name | (1R,5S)-3-phenyl-8-azabicyclo[3.2.1]oct-2-ene |
|---|---|
| PubChem CID | 92980020 |
| Molecular Formula | C13H15N |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.12 |
| IUPAC Name | (1R,5S)-3-phenyl-8-azabicyclo[3.2.1]oct-2-ene |
| SMILES | C1=C(c2ccccc2)C[C@@H]2CC[C@H]1N2 |
| InChI | InChI=1S/C13H15N/c1-2-4-10(5-3-1)11-8-12-6-7-13(9-11)14-12/h1-5,8,12-14H,6-7,9H2/t12-,13+/m1/s1 |
| InChIKey | VHBRUQHAUJNUAM-OLZOCXBDSA-N |
| XLogP | 2.59 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |