C13H14O — CID 102075089
(1S,5R)-3-phenyl-8-oxabicyclo[3.2.1]oct-2-ene (PubChem CID 102075089) has the molecular formula C13H14O and a molecular weight of 186.25 g/mol. Its IUPAC name is (1S,5R)-3-phenyl-8-oxabicyclo[3.2.1]oct-2-ene.
| Compound Name | (1S,5R)-3-phenyl-8-oxabicyclo[3.2.1]oct-2-ene |
|---|---|
| PubChem CID | 102075089 |
| Molecular Formula | C13H14O |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.10 |
| IUPAC Name | (1S,5R)-3-phenyl-8-oxabicyclo[3.2.1]oct-2-ene |
| SMILES | C1=C(c2ccccc2)C[C@H]2CC[C@@H]1O2 |
| InChI | InChI=1S/C13H14O/c1-2-4-10(5-3-1)11-8-12-6-7-13(9-11)14-12/h1-5,8,12-13H,6-7,9H2/t12-,13+/m0/s1 |
| InChIKey | GWGPVXLEUGWAPG-QWHCGFSZSA-N |
| XLogP | 3.02 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |