C24H26N4O — CID 92981232
(2R)-N-(4-aminophenyl)-1-benzyl-4-phenylpiperazine-2-carboxamide (PubChem CID 92981232) has the molecular formula C24H26N4O and a molecular weight of 386.50 g/mol. Its IUPAC name is (2R)-N-(4-aminophenyl)-1-benzyl-4-phenylpiperazine-2-carboxamide.
| Compound Name | (2R)-N-(4-aminophenyl)-1-benzyl-4-phenylpiperazine-2-carboxamide |
|---|---|
| PubChem CID | 92981232 |
| Molecular Formula | C24H26N4O |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | (2R)-N-(4-aminophenyl)-1-benzyl-4-phenylpiperazine-2-carboxamide |
| SMILES | Nc1ccc(NC(=O)[C@H]2CN(c3ccccc3)CCN2Cc2ccccc2)cc1 |
| InChI | InChI=1S/C24H26N4O/c25-20-11-13-21(14-12-20)26-24(29)23-18-27(22-9-5-2-6-10-22)15-16-28(23)17-19-7-3-1-4-8-19/h1-14,23H,15-18,25H2,(H,26,29)/t23-/m1/s1 |
| InChIKey | QRSCKBDDSSPKDI-HSZRJFAPSA-N |
| XLogP | 3.60 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|