C14H25NO2 — CID 929883
(4S)-N-cyclohexyl-2,2-dimethyloxane-4-carboxamide (PubChem CID 929883) has the molecular formula C14H25NO2 and a molecular weight of 239.36 g/mol. Its IUPAC name is (4S)-N-cyclohexyl-2,2-dimethyloxane-4-carboxamide.
| Compound Name | (4S)-N-cyclohexyl-2,2-dimethyloxane-4-carboxamide |
|---|---|
| PubChem CID | 929883 |
| Molecular Formula | C14H25NO2 |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.19 |
| IUPAC Name | (4S)-N-cyclohexyl-2,2-dimethyloxane-4-carboxamide |
| SMILES | CC1(C)C[C@@H](C(=O)NC2CCCCC2)CCO1 |
| InChI | InChI=1S/C14H25NO2/c1-14(2)10-11(8-9-17-14)13(16)15-12-6-4-3-5-7-12/h11-12H,3-10H2,1-2H3,(H,15,16)/t11-/m0/s1 |
| InChIKey | ATIGWZIUOICJKZ-NSHDSACASA-N |
| XLogP | 2.64 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |